C8H3BrF4O — CID 130136879
2-bromo-1-(2,5-difluorophenyl)-2,2-difluoroethanone (PubChem CID 130136879) has the molecular formula C8H3BrF4O and a molecular weight of 271.01 g/mol. Its IUPAC name is 2-bromo-1-(2,5-difluorophenyl)-2,2-difluoroethanone.
| Compound Name | 2-bromo-1-(2,5-difluorophenyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 130136879 |
| Molecular Formula | C8H3BrF4O |
| Molecular Weight | 271.01 g/mol |
| Exact Mass | 269.93 |
| IUPAC Name | 2-bromo-1-(2,5-difluorophenyl)-2,2-difluoroethanone |
| SMILES | O=C(c1cc(F)ccc1F)C(F)(F)Br |
| InChI | InChI=1S/C8H3BrF4O/c9-8(12,13)7(14)5-3-4(10)1-2-6(5)11/h1-3H |
| InChIKey | CCHAATKNRPSLKW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.01 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|