About 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone
2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone (PubChem CID 146006185) has the molecular formula C15H9BrF4O2
and a molecular weight of 377.13 g/mol. Its IUPAC name is 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone |
| PubChem CID | 146006185 |
| Molecular Formula | C15H9BrF4O2 |
| Molecular Weight | 377.13 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone |
| SMILES | O=C(c1ccc(COc2cc(F)ccc2F)cc1)C(F)(F)Br |
| InChI | InChI=1S/C15H9BrF4O2/c16-15(19,20)14(21)10-3-1-9(2-4-10)8-22-13-7-11(17)5-6-12(13)18/h1-7H,8H2 |
| InChIKey | PGCNCUXZPVFESG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.13 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone?
The IUPAC name of 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone (CID 146006185) is 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone.
What is the SMILES notation for 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone?
The canonical SMILES for 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone is O=C(c1ccc(COc2cc(F)ccc2F)cc1)C(F)(F)Br.
What is the InChIKey of 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone?
The InChIKey is PGCNCUXZPVFESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9BrF4O2/c16-15(19,20)14(21)10-3-1-9(2-4-10)8-22-13-7-11(17)5-6-12(13)18/h1-7H,8H2.
What are the key properties of 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone?
2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone has a molecular weight of 377.13 g/mol, XLogP of 4.71, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone is sourced from PubChem (CID 146006185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).