C15H9BrF4O2 — CID 146006185
2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone (PubChem CID 146006185) has the molecular formula C15H9BrF4O2 and a molecular weight of 377.13 g/mol. Its IUPAC name is 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone.
| Compound Name | 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone |
|---|---|
| PubChem CID | 146006185 |
| Molecular Formula | C15H9BrF4O2 |
| Molecular Weight | 377.13 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 2-bromo-1-[4-[(2,5-difluorophenoxy)methyl]phenyl]-2,2-difluoroethanone |
| SMILES | O=C(c1ccc(COc2cc(F)ccc2F)cc1)C(F)(F)Br |
| InChI | InChI=1S/C15H9BrF4O2/c16-15(19,20)14(21)10-3-1-9(2-4-10)8-22-13-7-11(17)5-6-12(13)18/h1-7H,8H2 |
| InChIKey | PGCNCUXZPVFESG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.13 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|