About (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium
(E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium (PubChem CID 71530301) has the molecular formula C28H23FO2Sn
and a molecular weight of 529.20 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium.
Molecular Properties
| Compound Name | (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium |
| PubChem CID | 71530301 |
| Molecular Formula | C28H23FO2Sn |
| Molecular Weight | 529.20 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium |
| SMILES | C/C(=C\c1ccc(F)cc1)C(=O)[O-].c1ccc([Sn+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C10H9FO2.3C6H5.Sn/c1-7(10(12)13)6-8-2-4-9(11)5-3-8;3*1-2-4-6-5-3-1;/h2-6H,1H3,(H,12,13);3*1-5H;/q;;;;+1/p-1/b7-6+;;;; |
| InChIKey | JRVZQNCAVUMLFU-MNPOOLNOSA-M |
| XLogP | 3.18 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 529.20 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium?
The IUPAC name of (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium (CID 71530301) is (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium.
What is the SMILES notation for (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium?
The canonical SMILES for (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium is C/C(=C\c1ccc(F)cc1)C(=O)[O-].c1ccc([Sn+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium?
The InChIKey is JRVZQNCAVUMLFU-MNPOOLNOSA-M. The full InChI is InChI=1S/C10H9FO2.3C6H5.Sn/c1-7(10(12)13)6-8-2-4-9(11)5-3-8;3*1-2-4-6-5-3-1;/h2-6H,1H3,(H,12,13);3*1-5H;/q;;;;+1/p-1/b7-6+;;;;.
What are the key properties of (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium?
(E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium has a molecular weight of 529.20 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4-fluorophenyl)-2-methylprop-2-enoate;triphenylstannanylium is sourced from PubChem (CID 71530301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).