C14H10F2N2O2 — CID 94285001
2-(2,5-difluorophenyl)-2-oxo-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 94285001) has the molecular formula C14H10F2N2O2 and a molecular weight of 276.24 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-2-oxo-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-(2,5-difluorophenyl)-2-oxo-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 94285001 |
| Molecular Formula | C14H10F2N2O2 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-(2,5-difluorophenyl)-2-oxo-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(NCc1ccccn1)C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H10F2N2O2/c15-9-4-5-12(16)11(7-9)13(19)14(20)18-8-10-3-1-2-6-17-10/h1-7H,8H2,(H,18,20) |
| InChIKey | DKBICFGYHGGFQS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|