C15H14FN3O2 — CID 4781382
2-fluoro-N-[2-oxo-2-(pyridin-2-ylmethylamino)ethyl]benzamide (PubChem CID 4781382) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is 2-fluoro-N-[2-oxo-2-(pyridin-2-ylmethylamino)ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-oxo-2-(pyridin-2-ylmethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 4781382 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-fluoro-N-[2-oxo-2-(pyridin-2-ylmethylamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1F)NCc1ccccn1 |
| InChI | InChI=1S/C15H14FN3O2/c16-13-7-2-1-6-12(13)15(21)19-10-14(20)18-9-11-5-3-4-8-17-11/h1-8H,9-10H2,(H,18,20)(H,19,21) |
| InChIKey | SZFPHJUUNWXIPW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |