C15H12F2N2O2 — CID 78802909
2,5-difluoro-N-[4-(methylcarbamoyl)phenyl]benzamide (PubChem CID 78802909) has the molecular formula C15H12F2N2O2 and a molecular weight of 290.27 g/mol. Its IUPAC name is 2,5-difluoro-N-[4-(methylcarbamoyl)phenyl]benzamide.
| Compound Name | 2,5-difluoro-N-[4-(methylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 78802909 |
| Molecular Formula | C15H12F2N2O2 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2,5-difluoro-N-[4-(methylcarbamoyl)phenyl]benzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C15H12F2N2O2/c1-18-14(20)9-2-5-11(6-3-9)19-15(21)12-8-10(16)4-7-13(12)17/h2-8H,1H3,(H,18,20)(H,19,21) |
| InChIKey | DTFDPSXQHPECAP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |