C21H16F2N2O3 — CID 4796910
2,4-difluoro-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]benzamide (PubChem CID 4796910) has the molecular formula C21H16F2N2O3 and a molecular weight of 382.37 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4796910 |
| Molecular Formula | C21H16F2N2O3 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2,4-difluoro-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NC(=O)c3ccc(F)cc3F)cc2)cc1 |
| InChI | InChI=1S/C21H16F2N2O3/c1-28-17-9-7-16(8-10-17)24-20(26)13-2-5-15(6-3-13)25-21(27)18-11-4-14(22)12-19(18)23/h2-12H,1H3,(H,24,26)(H,25,27) |
| InChIKey | NKZIIPWHXMIXDF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |