C21H15Cl2FN2O3 — CID 46823403
2,4-dichloro-5-fluoro-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]benzamide (PubChem CID 46823403) has the molecular formula C21H15Cl2FN2O3 and a molecular weight of 433.27 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46823403 |
| Molecular Formula | C21H15Cl2FN2O3 |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NC(=O)c3cc(F)c(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C21H15Cl2FN2O3/c1-29-15-8-6-14(7-9-15)25-20(27)12-2-4-13(5-3-12)26-21(28)16-10-19(24)18(23)11-17(16)22/h2-11H,1H3,(H,25,27)(H,26,28) |
| InChIKey | LYYPLYXIQFVODV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|