C15H12Cl2FNO — CID 27667437
2,4-dichloro-N-(4-ethylphenyl)-5-fluorobenzamide (PubChem CID 27667437) has the molecular formula C15H12Cl2FNO and a molecular weight of 312.17 g/mol. Its IUPAC name is 2,4-dichloro-N-(4-ethylphenyl)-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-(4-ethylphenyl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 27667437 |
| Molecular Formula | C15H12Cl2FNO |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2,4-dichloro-N-(4-ethylphenyl)-5-fluorobenzamide |
| SMILES | CCc1ccc(NC(=O)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H12Cl2FNO/c1-2-9-3-5-10(6-4-9)19-15(20)11-7-14(18)13(17)8-12(11)16/h3-8H,2H2,1H3,(H,19,20) |
| InChIKey | PPEVEEKEMXDEKO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|