C20H18ClFN4O3S — CID 175544014
2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-N-(4-ethylphenyl)-4-fluorobenzamide (PubChem CID 175544014) has the molecular formula C20H18ClFN4O3S and a molecular weight of 448.91 g/mol. Its IUPAC name is 2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-N-(4-ethylphenyl)-4-fluorobenzamide.
| Compound Name | 2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-N-(4-ethylphenyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 175544014 |
| Molecular Formula | C20H18ClFN4O3S |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-N-(4-ethylphenyl)-4-fluorobenzamide |
| SMILES | CCc1ccc(NC(=O)c2cc(-n3c(=O)n(C)c(=S)n(C)c3=O)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C20H18ClFN4O3S/c1-4-11-5-7-12(8-6-11)23-17(27)13-9-16(15(22)10-14(13)21)26-18(28)24(2)20(30)25(3)19(26)29/h5-10H,4H2,1-3H3,(H,23,27) |
| InChIKey | UTAKVEAEDKLPHP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|