C16H13ClF2N2O2 — CID 35364807
2-chloro-4,5-difluoro-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]benzamide (PubChem CID 35364807) has the molecular formula C16H13ClF2N2O2 and a molecular weight of 338.74 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 35364807 |
| Molecular Formula | C16H13ClF2N2O2 |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]benzamide |
| SMILES | CNC(=O)Cc1ccc(NC(=O)c2cc(F)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C16H13ClF2N2O2/c1-20-15(22)6-9-2-4-10(5-3-9)21-16(23)11-7-13(18)14(19)8-12(11)17/h2-5,7-8H,6H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | MBLOPFJCCCTCJL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|