C18H17ClF2N2O2 — CID 26899774
2-chloro-N-[4-(diethylcarbamoyl)phenyl]-4,5-difluorobenzamide (PubChem CID 26899774) has the molecular formula C18H17ClF2N2O2 and a molecular weight of 366.80 g/mol. Its IUPAC name is 2-chloro-N-[4-(diethylcarbamoyl)phenyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[4-(diethylcarbamoyl)phenyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 26899774 |
| Molecular Formula | C18H17ClF2N2O2 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-chloro-N-[4-(diethylcarbamoyl)phenyl]-4,5-difluorobenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)c2cc(F)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C18H17ClF2N2O2/c1-3-23(4-2)18(25)11-5-7-12(8-6-11)22-17(24)13-9-15(20)16(21)10-14(13)19/h5-10H,3-4H2,1-2H3,(H,22,24) |
| InChIKey | GSZFPJPUTNBJJU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|