C16H13ClF2N2O2 — CID 8698727
2-chloro-N-[4-(dimethylcarbamoyl)phenyl]-4,5-difluorobenzamide (PubChem CID 8698727) has the molecular formula C16H13ClF2N2O2 and a molecular weight of 338.74 g/mol. Its IUPAC name is 2-chloro-N-[4-(dimethylcarbamoyl)phenyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[4-(dimethylcarbamoyl)phenyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 8698727 |
| Molecular Formula | C16H13ClF2N2O2 |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-chloro-N-[4-(dimethylcarbamoyl)phenyl]-4,5-difluorobenzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)c2cc(F)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C16H13ClF2N2O2/c1-21(2)16(23)9-3-5-10(6-4-9)20-15(22)11-7-13(18)14(19)8-12(11)17/h3-8H,1-2H3,(H,20,22) |
| InChIKey | AJNGMVNVYSHNCO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|