C15H13ClF2N2O — CID 78776354
2-chloro-N-[4-(dimethylamino)phenyl]-4,5-difluorobenzamide (PubChem CID 78776354) has the molecular formula C15H13ClF2N2O and a molecular weight of 310.73 g/mol. Its IUPAC name is 2-chloro-N-[4-(dimethylamino)phenyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[4-(dimethylamino)phenyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 78776354 |
| Molecular Formula | C15H13ClF2N2O |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-chloro-N-[4-(dimethylamino)phenyl]-4,5-difluorobenzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cc(F)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C15H13ClF2N2O/c1-20(2)10-5-3-9(4-6-10)19-15(21)11-7-13(17)14(18)8-12(11)16/h3-8H,1-2H3,(H,19,21) |
| InChIKey | VCKDNJYBGNLZHV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|