C15H14ClF2N3O3S — CID 1250955
2-chloro-N-[3-(dimethylsulfamoylamino)phenyl]-4,5-difluorobenzamide (PubChem CID 1250955) has the molecular formula C15H14ClF2N3O3S and a molecular weight of 389.81 g/mol. Its IUPAC name is 2-chloro-N-[3-(dimethylsulfamoylamino)phenyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[3-(dimethylsulfamoylamino)phenyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 1250955 |
| Molecular Formula | C15H14ClF2N3O3S |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-chloro-N-[3-(dimethylsulfamoylamino)phenyl]-4,5-difluorobenzamide |
| SMILES | CN(C)S(=O)(=O)Nc1cccc(NC(=O)c2cc(F)c(F)cc2Cl)c1 |
| InChI | InChI=1S/C15H14ClF2N3O3S/c1-21(2)25(23,24)20-10-5-3-4-9(6-10)19-15(22)11-7-13(17)14(18)8-12(11)16/h3-8,20H,1-2H3,(H,19,22) |
| InChIKey | ICLGPUMWZJHYCJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|