C19H15ClF2N2O5 — CID 168569299
dimethyl (E)-2-[3-[(2-chloro-4,5-difluorobenzoyl)amino]anilino]but-2-enedioate (PubChem CID 168569299) has the molecular formula C19H15ClF2N2O5 and a molecular weight of 424.79 g/mol. Its IUPAC name is dimethyl (E)-2-[3-[(2-chloro-4,5-difluorobenzoyl)amino]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-[(2-chloro-4,5-difluorobenzoyl)amino]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569299 |
| Molecular Formula | C19H15ClF2N2O5 |
| Molecular Weight | 424.79 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | dimethyl (E)-2-[3-[(2-chloro-4,5-difluorobenzoyl)amino]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc(NC(=O)c2cc(F)c(F)cc2Cl)c1)C(=O)OC |
| InChI | InChI=1S/C19H15ClF2N2O5/c1-28-17(25)9-16(19(27)29-2)23-10-4-3-5-11(6-10)24-18(26)12-7-14(21)15(22)8-13(12)20/h3-9,23H,1-2H3,(H,24,26)/b16-9+ |
| InChIKey | OVFYQCCNDGGXKJ-CXUHLZMHSA-N |
| XLogP | 3.51 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.79 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|