C13H11F2NO6 — CID 168566055
2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-4,5-difluorobenzoic acid (PubChem CID 168566055) has the molecular formula C13H11F2NO6 and a molecular weight of 315.23 g/mol. Its IUPAC name is 2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-4,5-difluorobenzoic acid.
| Compound Name | 2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 168566055 |
| Molecular Formula | C13H11F2NO6 |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-4,5-difluorobenzoic acid |
| SMILES | COC(=O)/C=C(/Nc1cc(F)c(F)cc1C(=O)O)C(=O)OC |
| InChI | InChI=1S/C13H11F2NO6/c1-21-11(17)5-10(13(20)22-2)16-9-4-8(15)7(14)3-6(9)12(18)19/h3-5,16H,1-2H3,(H,18,19)/b10-5+ |
| InChIKey | XIOONHCNGKXQIS-BJMVGYQFSA-N |
| XLogP | 1.30 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|