C14H14INO7 — CID 168569574
4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-iodo-2-methoxybenzoic acid (PubChem CID 168569574) has the molecular formula C14H14INO7 and a molecular weight of 435.17 g/mol. Its IUPAC name is 4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-iodo-2-methoxybenzoic acid.
| Compound Name | 4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-iodo-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 168569574 |
| Molecular Formula | C14H14INO7 |
| Molecular Weight | 435.17 g/mol |
| Exact Mass | 434.98 |
| IUPAC Name | 4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-iodo-2-methoxybenzoic acid |
| SMILES | COC(=O)/C=C(/Nc1cc(OC)c(C(=O)O)cc1I)C(=O)OC |
| InChI | InChI=1S/C14H14INO7/c1-21-11-5-9(8(15)4-7(11)13(18)19)16-10(14(20)23-3)6-12(17)22-2/h4-6,16H,1-3H3,(H,18,19)/b10-6+ |
| InChIKey | CCGITGDNAVZYBT-UXBLZVDNSA-N |
| XLogP | 1.64 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|