C16H20N2O5 — CID 168566046
dimethyl (E)-2-(2-acetamido-4,5-dimethylanilino)but-2-enedioate (PubChem CID 168566046) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is dimethyl (E)-2-(2-acetamido-4,5-dimethylanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(2-acetamido-4,5-dimethylanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168566046 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | dimethyl (E)-2-(2-acetamido-4,5-dimethylanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(C)c(C)cc1NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C16H20N2O5/c1-9-6-12(17-11(3)19)13(7-10(9)2)18-14(16(21)23-5)8-15(20)22-4/h6-8,18H,1-5H3,(H,17,19)/b14-8+ |
| InChIKey | UHWSJYUMPDXYGS-RIYZIHGNSA-N |
| XLogP | 1.90 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|