C13H12BrF2NO5 — CID 168569589
dimethyl (E)-2-(5-bromo-3,4-difluoro-2-methoxyanilino)but-2-enedioate (PubChem CID 168569589) has the molecular formula C13H12BrF2NO5 and a molecular weight of 380.14 g/mol. Its IUPAC name is dimethyl (E)-2-(5-bromo-3,4-difluoro-2-methoxyanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(5-bromo-3,4-difluoro-2-methoxyanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168569589 |
| Molecular Formula | C13H12BrF2NO5 |
| Molecular Weight | 380.14 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | dimethyl (E)-2-(5-bromo-3,4-difluoro-2-methoxyanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(Br)c(F)c(F)c1OC)C(=O)OC |
| InChI | InChI=1S/C13H12BrF2NO5/c1-20-9(18)5-8(13(19)22-3)17-7-4-6(14)10(15)11(16)12(7)21-2/h4-5,17H,1-3H3/b8-5+ |
| InChIKey | WBQXTEVKSUGAQQ-VMPITWQZSA-N |
| XLogP | 2.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.14 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|