C14H10BrF6NO4 — CID 168568026
dimethyl (E)-2-[2-bromo-4,5-bis(trifluoromethyl)anilino]but-2-enedioate (PubChem CID 168568026) has the molecular formula C14H10BrF6NO4 and a molecular weight of 450.13 g/mol. Its IUPAC name is dimethyl (E)-2-[2-bromo-4,5-bis(trifluoromethyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-bromo-4,5-bis(trifluoromethyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568026 |
| Molecular Formula | C14H10BrF6NO4 |
| Molecular Weight | 450.13 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | dimethyl (E)-2-[2-bromo-4,5-bis(trifluoromethyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(C(F)(F)F)c(C(F)(F)F)cc1Br)C(=O)OC |
| InChI | InChI=1S/C14H10BrF6NO4/c1-25-11(23)5-10(12(24)26-2)22-9-4-7(14(19,20)21)6(3-8(9)15)13(16,17)18/h3-5,22H,1-2H3/b10-5+ |
| InChIKey | WOMLJIRQMZFARO-BJMVGYQFSA-N |
| XLogP | 4.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.13 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|