C14H12F5NO4 — CID 168567536
dimethyl (E)-2-[2-(1,1,2,2,2-pentafluoroethyl)anilino]but-2-enedioate (PubChem CID 168567536) has the molecular formula C14H12F5NO4 and a molecular weight of 353.24 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(1,1,2,2,2-pentafluoroethyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-(1,1,2,2,2-pentafluoroethyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567536 |
| Molecular Formula | C14H12F5NO4 |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | dimethyl (E)-2-[2-(1,1,2,2,2-pentafluoroethyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccccc1C(F)(F)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C14H12F5NO4/c1-23-11(21)7-10(12(22)24-2)20-9-6-4-3-5-8(9)13(15,16)14(17,18)19/h3-7,20H,1-2H3/b10-7+ |
| InChIKey | JVXPVACYFGLMEO-JXMROGBWSA-N |
| XLogP | 2.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|