C18H22N2O5 — CID 168568395
dimethyl (E)-2-[2-(piperidine-1-carbonyl)anilino]but-2-enedioate (PubChem CID 168568395) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(piperidine-1-carbonyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-(piperidine-1-carbonyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568395 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | dimethyl (E)-2-[2-(piperidine-1-carbonyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccccc1C(=O)N1CCCCC1)C(=O)OC |
| InChI | InChI=1S/C18H22N2O5/c1-24-16(21)12-15(18(23)25-2)19-14-9-5-4-8-13(14)17(22)20-10-6-3-7-11-20/h4-5,8-9,12,19H,3,6-7,10-11H2,1-2H3/b15-12+ |
| InChIKey | LGWILYHZEDFSIX-NTCAYCPXSA-N |
| XLogP | 1.95 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|