C26H26N2O2 — CID 1341137
2,2-diphenyl-N-[2-(piperidine-1-carbonyl)phenyl]acetamide (PubChem CID 1341137) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2,2-diphenyl-N-[2-(piperidine-1-carbonyl)phenyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[2-(piperidine-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1341137 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2,2-diphenyl-N-[2-(piperidine-1-carbonyl)phenyl]acetamide |
| SMILES | O=C(Nc1ccccc1C(=O)N1CCCCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O2/c29-25(24(20-12-4-1-5-13-20)21-14-6-2-7-15-21)27-23-17-9-8-16-22(23)26(30)28-18-10-3-11-19-28/h1-2,4-9,12-17,24H,3,10-11,18-19H2,(H,27,29) |
| InChIKey | RKMNLLGNYAMYQS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |