C21H23N3O4 — CID 41010376
N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[2-(pyrrolidine-1-carbonyl)phenyl]oxamide (PubChem CID 41010376) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[2-(pyrrolidine-1-carbonyl)phenyl]oxamide.
| Compound Name | N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[2-(pyrrolidine-1-carbonyl)phenyl]oxamide |
|---|---|
| PubChem CID | 41010376 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[2-(pyrrolidine-1-carbonyl)phenyl]oxamide |
| SMILES | O=C(NC[C@H](O)c1ccccc1)C(=O)Nc1ccccc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C21H23N3O4/c25-18(15-8-2-1-3-9-15)14-22-19(26)20(27)23-17-11-5-4-10-16(17)21(28)24-12-6-7-13-24/h1-5,8-11,18,25H,6-7,12-14H2,(H,22,26)(H,23,27)/t18-/m0/s1 |
| InChIKey | QLKXYRLRGQBGMW-SFHVURJKSA-N |
| XLogP | 1.71 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|