C18H21ClN2O5 — CID 168569953
dimethyl (E)-2-[4-chloro-2-(piperidine-1-carbonyl)anilino]but-2-enedioate (PubChem CID 168569953) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is dimethyl (E)-2-[4-chloro-2-(piperidine-1-carbonyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-chloro-2-(piperidine-1-carbonyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569953 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | dimethyl (E)-2-[4-chloro-2-(piperidine-1-carbonyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(Cl)cc1C(=O)N1CCCCC1)C(=O)OC |
| InChI | InChI=1S/C18H21ClN2O5/c1-25-16(22)11-15(18(24)26-2)20-14-7-6-12(19)10-13(14)17(23)21-8-4-3-5-9-21/h6-7,10-11,20H,3-5,8-9H2,1-2H3/b15-11+ |
| InChIKey | BGEYGQLRENYVBI-RVDMUPIBSA-N |
| XLogP | 2.61 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|