C17H22N2O4 — CID 168566366
dimethyl (E)-2-[2-(pyrrolidin-1-ylmethyl)anilino]but-2-enedioate (PubChem CID 168566366) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(pyrrolidin-1-ylmethyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-(pyrrolidin-1-ylmethyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168566366 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | dimethyl (E)-2-[2-(pyrrolidin-1-ylmethyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccccc1CN1CCCC1)C(=O)OC |
| InChI | InChI=1S/C17H22N2O4/c1-22-16(20)11-15(17(21)23-2)18-14-8-4-3-7-13(14)12-19-9-5-6-10-19/h3-4,7-8,11,18H,5-6,9-10,12H2,1-2H3/b15-11+ |
| InChIKey | BIGLEZORTNNLPT-RVDMUPIBSA-N |
| XLogP | 1.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|