C12H9Br2F2NO4 — CID 168566121
dimethyl (E)-2-(2,6-dibromo-3,4-difluoroanilino)but-2-enedioate (PubChem CID 168566121) has the molecular formula C12H9Br2F2NO4 and a molecular weight of 429.01 g/mol. Its IUPAC name is dimethyl (E)-2-(2,6-dibromo-3,4-difluoroanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(2,6-dibromo-3,4-difluoroanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168566121 |
| Molecular Formula | C12H9Br2F2NO4 |
| Molecular Weight | 429.01 g/mol |
| Exact Mass | 426.89 |
| IUPAC Name | dimethyl (E)-2-(2,6-dibromo-3,4-difluoroanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1c(Br)cc(F)c(F)c1Br)C(=O)OC |
| InChI | InChI=1S/C12H9Br2F2NO4/c1-20-8(18)4-7(12(19)21-2)17-11-5(13)3-6(15)10(16)9(11)14/h3-4,17H,1-2H3/b7-4+ |
| InChIKey | XGLRCCOTKBOKHP-QPJJXVBHSA-N |
| XLogP | 3.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.01 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|