C14H16FNO4 — CID 168569489
dimethyl (E)-2-(4-fluoro-2,6-dimethylanilino)but-2-enedioate (PubChem CID 168569489) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is dimethyl (E)-2-(4-fluoro-2,6-dimethylanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(4-fluoro-2,6-dimethylanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168569489 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | dimethyl (E)-2-(4-fluoro-2,6-dimethylanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1c(C)cc(F)cc1C)C(=O)OC |
| InChI | InChI=1S/C14H16FNO4/c1-8-5-10(15)6-9(2)13(8)16-11(14(18)20-4)7-12(17)19-3/h5-7,16H,1-4H3/b11-7+ |
| InChIKey | YYUPJVPFPXVWIW-YRNVUSSQSA-N |
| XLogP | 2.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|