C14H13BrFNO6 — CID 168566974
2-bromo-6-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-3-fluoro-5-methylbenzoic acid (PubChem CID 168566974) has the molecular formula C14H13BrFNO6 and a molecular weight of 390.16 g/mol. Its IUPAC name is 2-bromo-6-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-3-fluoro-5-methylbenzoic acid.
| Compound Name | 2-bromo-6-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-3-fluoro-5-methylbenzoic acid |
|---|---|
| PubChem CID | 168566974 |
| Molecular Formula | C14H13BrFNO6 |
| Molecular Weight | 390.16 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 2-bromo-6-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-3-fluoro-5-methylbenzoic acid |
| SMILES | COC(=O)/C=C(/Nc1c(C)cc(F)c(Br)c1C(=O)O)C(=O)OC |
| InChI | InChI=1S/C14H13BrFNO6/c1-6-4-7(16)11(15)10(13(19)20)12(6)17-8(14(21)23-3)5-9(18)22-2/h4-5,17H,1-3H3,(H,19,20)/b8-5+ |
| InChIKey | IIEFQSDBMBTSFR-VMPITWQZSA-N |
| XLogP | 2.24 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|