C17H23NO4 — CID 168569068
dimethyl (E)-2-(2,6-diethyl-4-methylanilino)but-2-enedioate (PubChem CID 168569068) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is dimethyl (E)-2-(2,6-diethyl-4-methylanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(2,6-diethyl-4-methylanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168569068 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | dimethyl (E)-2-(2,6-diethyl-4-methylanilino)but-2-enedioate |
| SMILES | CCc1cc(C)cc(CC)c1N/C(=C/C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H23NO4/c1-6-12-8-11(3)9-13(7-2)16(12)18-14(17(20)22-5)10-15(19)21-4/h8-10,18H,6-7H2,1-5H3/b14-10+ |
| InChIKey | KNBDXRFXOFHRST-GXDHUFHOSA-N |
| XLogP | 2.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|