C17H18N2O4 — CID 168570599
dimethyl (E)-2-[4-(2-cyanoethenyl)-2,6-dimethylanilino]but-2-enedioate (PubChem CID 168570599) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(2-cyanoethenyl)-2,6-dimethylanilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(2-cyanoethenyl)-2,6-dimethylanilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570599 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | dimethyl (E)-2-[4-(2-cyanoethenyl)-2,6-dimethylanilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1c(C)cc(C=CC#N)cc1C)C(=O)OC |
| InChI | InChI=1S/C17H18N2O4/c1-11-8-13(6-5-7-18)9-12(2)16(11)19-14(17(21)23-4)10-15(20)22-3/h5-6,8-10,19H,1-4H3/b6-5?,14-10+ |
| InChIKey | IQYASEYNCCZBDW-XYYLACKTSA-N |
| XLogP | 2.48 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|