C18H23N3O5 — CID 168566073
dimethyl (E)-2-[(1,3-diethyl-6-methyl-2-oxobenzimidazol-5-yl)amino]but-2-enedioate (PubChem CID 168566073) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is dimethyl (E)-2-[(1,3-diethyl-6-methyl-2-oxobenzimidazol-5-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(1,3-diethyl-6-methyl-2-oxobenzimidazol-5-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168566073 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | dimethyl (E)-2-[(1,3-diethyl-6-methyl-2-oxobenzimidazol-5-yl)amino]but-2-enedioate |
| SMILES | CCn1c(=O)n(CC)c2cc(N/C(=C/C(=O)OC)C(=O)OC)c(C)cc21 |
| InChI | InChI=1S/C18H23N3O5/c1-6-20-14-8-11(3)12(9-15(14)21(7-2)18(20)24)19-13(17(23)26-5)10-16(22)25-4/h8-10,19H,6-7H2,1-5H3/b13-10+ |
| InChIKey | KGWVZTAMDASZRR-JLHYYAGUSA-N |
| XLogP | 1.79 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|