C13H13N3O4S — CID 168568282
dimethyl (E)-2-[(6-methyl-2,1,3-benzothiadiazol-5-yl)amino]but-2-enedioate (PubChem CID 168568282) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is dimethyl (E)-2-[(6-methyl-2,1,3-benzothiadiazol-5-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(6-methyl-2,1,3-benzothiadiazol-5-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168568282 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | dimethyl (E)-2-[(6-methyl-2,1,3-benzothiadiazol-5-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc2nsnc2cc1C)C(=O)OC |
| InChI | InChI=1S/C13H13N3O4S/c1-7-4-9-10(16-21-15-9)5-8(7)14-11(13(18)20-3)6-12(17)19-2/h4-6,14H,1-3H3/b11-6+ |
| InChIKey | MVYFALBYNHJLOD-IZZDOVSWSA-N |
| XLogP | 1.64 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|