C17H22N2O5 — CID 168567244
dimethyl (E)-2-[3-methyl-4-(2-methylpropanoylamino)anilino]but-2-enedioate (PubChem CID 168567244) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is dimethyl (E)-2-[3-methyl-4-(2-methylpropanoylamino)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-methyl-4-(2-methylpropanoylamino)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567244 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | dimethyl (E)-2-[3-methyl-4-(2-methylpropanoylamino)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(NC(=O)C(C)C)c(C)c1)C(=O)OC |
| InChI | InChI=1S/C17H22N2O5/c1-10(2)16(21)19-13-7-6-12(8-11(13)3)18-14(17(22)24-5)9-15(20)23-4/h6-10,18H,1-5H3,(H,19,21)/b14-9+ |
| InChIKey | PAZSBXWFCLDYDR-NTEUORMPSA-N |
| XLogP | 2.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|