C13H13F2NO4 — CID 168569894
dimethyl (E)-2-(2,6-difluoro-4-methylanilino)but-2-enedioate (PubChem CID 168569894) has the molecular formula C13H13F2NO4 and a molecular weight of 285.25 g/mol. Its IUPAC name is dimethyl (E)-2-(2,6-difluoro-4-methylanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(2,6-difluoro-4-methylanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168569894 |
| Molecular Formula | C13H13F2NO4 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | dimethyl (E)-2-(2,6-difluoro-4-methylanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1c(F)cc(C)cc1F)C(=O)OC |
| InChI | InChI=1S/C13H13F2NO4/c1-7-4-8(14)12(9(15)5-7)16-10(13(18)20-3)6-11(17)19-2/h4-6,16H,1-3H3/b10-6+ |
| InChIKey | GBDFZJQGGMRYOE-UXBLZVDNSA-N |
| XLogP | 1.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|