C12H12Cl2N2O6S — CID 168566914
dimethyl (E)-2-(2,6-dichloro-4-sulfamoylanilino)but-2-enedioate (PubChem CID 168566914) has the molecular formula C12H12Cl2N2O6S and a molecular weight of 383.21 g/mol. Its IUPAC name is dimethyl (E)-2-(2,6-dichloro-4-sulfamoylanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(2,6-dichloro-4-sulfamoylanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168566914 |
| Molecular Formula | C12H12Cl2N2O6S |
| Molecular Weight | 383.21 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | dimethyl (E)-2-(2,6-dichloro-4-sulfamoylanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1c(Cl)cc(S(N)(=O)=O)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C12H12Cl2N2O6S/c1-21-10(17)5-9(12(18)22-2)16-11-7(13)3-6(4-8(11)14)23(15,19)20/h3-5,16H,1-2H3,(H2,15,19,20)/b9-5+ |
| InChIKey | UOITZKYDPZZDSM-WEVVVXLNSA-N |
| XLogP | 1.28 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|