C13H10Cl2F3NO4S — CID 168567686
dimethyl (E)-2-[2,6-dichloro-4-(trifluoromethylsulfanyl)anilino]but-2-enedioate (PubChem CID 168567686) has the molecular formula C13H10Cl2F3NO4S and a molecular weight of 404.19 g/mol. Its IUPAC name is dimethyl (E)-2-[2,6-dichloro-4-(trifluoromethylsulfanyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2,6-dichloro-4-(trifluoromethylsulfanyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567686 |
| Molecular Formula | C13H10Cl2F3NO4S |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 402.97 |
| IUPAC Name | dimethyl (E)-2-[2,6-dichloro-4-(trifluoromethylsulfanyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1c(Cl)cc(SC(F)(F)F)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C13H10Cl2F3NO4S/c1-22-10(20)5-9(12(21)23-2)19-11-7(14)3-6(4-8(11)15)24-13(16,17)18/h3-5,19H,1-2H3/b9-5+ |
| InChIKey | KVADXSNMCGWVGT-WEVVVXLNSA-N |
| XLogP | 4.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|