C12H10Cl3NO4 — CID 168570328
dimethyl (E)-2-(3,4,5-trichloroanilino)but-2-enedioate (PubChem CID 168570328) has the molecular formula C12H10Cl3NO4 and a molecular weight of 338.57 g/mol. Its IUPAC name is dimethyl (E)-2-(3,4,5-trichloroanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(3,4,5-trichloroanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168570328 |
| Molecular Formula | C12H10Cl3NO4 |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | dimethyl (E)-2-(3,4,5-trichloroanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(Cl)c(Cl)c(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C12H10Cl3NO4/c1-19-10(17)5-9(12(18)20-2)16-6-3-7(13)11(15)8(14)4-6/h3-5,16H,1-2H3/b9-5+ |
| InChIKey | ICYUIBCYGCUGEW-WEVVVXLNSA-N |
| XLogP | 3.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|