C19H16Cl2N2O5 — CID 168569734
dimethyl (E)-2-[4-[(2,4-dichlorobenzoyl)amino]anilino]but-2-enedioate (PubChem CID 168569734) has the molecular formula C19H16Cl2N2O5 and a molecular weight of 423.25 g/mol. Its IUPAC name is dimethyl (E)-2-[4-[(2,4-dichlorobenzoyl)amino]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-[(2,4-dichlorobenzoyl)amino]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569734 |
| Molecular Formula | C19H16Cl2N2O5 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | dimethyl (E)-2-[4-[(2,4-dichlorobenzoyl)amino]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1)C(=O)OC |
| InChI | InChI=1S/C19H16Cl2N2O5/c1-27-17(24)10-16(19(26)28-2)22-12-4-6-13(7-5-12)23-18(25)14-8-3-11(20)9-15(14)21/h3-10,22H,1-2H3,(H,23,25)/b16-10+ |
| InChIKey | CYSZTRYOMHOQTR-MHWRWJLKSA-N |
| XLogP | 3.89 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|