C22H18Cl2N2O2 — CID 2206480
2,4-dichloro-N-[4-[(3,5-dimethylbenzoyl)amino]phenyl]benzamide (PubChem CID 2206480) has the molecular formula C22H18Cl2N2O2 and a molecular weight of 413.30 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[(3,5-dimethylbenzoyl)amino]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[(3,5-dimethylbenzoyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 2206480 |
| Molecular Formula | C22H18Cl2N2O2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2,4-dichloro-N-[4-[(3,5-dimethylbenzoyl)amino]phenyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)Nc2ccc(NC(=O)c3ccc(Cl)cc3Cl)cc2)c1 |
| InChI | InChI=1S/C22H18Cl2N2O2/c1-13-9-14(2)11-15(10-13)21(27)25-17-4-6-18(7-5-17)26-22(28)19-8-3-16(23)12-20(19)24/h3-12H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | IDSZHCMHCMCEDM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |