C26H23N3O6 — CID 168568188
dimethyl (E)-2-[3,5-bis(phenylcarbamoyl)anilino]but-2-enedioate (PubChem CID 168568188) has the molecular formula C26H23N3O6 and a molecular weight of 473.49 g/mol. Its IUPAC name is dimethyl (E)-2-[3,5-bis(phenylcarbamoyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3,5-bis(phenylcarbamoyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568188 |
| Molecular Formula | C26H23N3O6 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | dimethyl (E)-2-[3,5-bis(phenylcarbamoyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(C(=O)Nc2ccccc2)cc(C(=O)Nc2ccccc2)c1)C(=O)OC |
| InChI | InChI=1S/C26H23N3O6/c1-34-23(30)16-22(26(33)35-2)27-21-14-17(24(31)28-19-9-5-3-6-10-19)13-18(15-21)25(32)29-20-11-7-4-8-12-20/h3-16,27H,1-2H3,(H,28,31)(H,29,32)/b22-16+ |
| InChIKey | ZSWDSTAMGUJILH-CJLVFECKSA-N |
| XLogP | 3.83 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|