C20H20N2O6 — CID 168569023
dimethyl (E)-2-[3-(phenylmethoxycarbonylamino)anilino]but-2-enedioate (PubChem CID 168569023) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is dimethyl (E)-2-[3-(phenylmethoxycarbonylamino)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-(phenylmethoxycarbonylamino)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569023 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | dimethyl (E)-2-[3-(phenylmethoxycarbonylamino)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc(NC(=O)OCc2ccccc2)c1)C(=O)OC |
| InChI | InChI=1S/C20H20N2O6/c1-26-18(23)12-17(19(24)27-2)21-15-9-6-10-16(11-15)22-20(25)28-13-14-7-4-3-5-8-14/h3-12,21H,13H2,1-2H3,(H,22,25)/b17-12+ |
| InChIKey | ULRRDOHHEUUYOQ-SFQUDFHCSA-N |
| XLogP | 3.08 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|