C22H20N2O8 — CID 168568509
4-[[3-[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]phenyl]-3-oxopropanoyl]amino]benzoic acid (PubChem CID 168568509) has the molecular formula C22H20N2O8 and a molecular weight of 440.41 g/mol. Its IUPAC name is 4-[[3-[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]phenyl]-3-oxopropanoyl]amino]benzoic acid.
| Compound Name | 4-[[3-[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]phenyl]-3-oxopropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 168568509 |
| Molecular Formula | C22H20N2O8 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 4-[[3-[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]phenyl]-3-oxopropanoyl]amino]benzoic acid |
| SMILES | COC(=O)/C=C(/Nc1ccc(C(=O)CC(=O)Nc2ccc(C(=O)O)cc2)cc1)C(=O)OC |
| InChI | InChI=1S/C22H20N2O8/c1-31-20(27)11-17(22(30)32-2)23-15-7-3-13(4-8-15)18(25)12-19(26)24-16-9-5-14(6-10-16)21(28)29/h3-11,23H,12H2,1-2H3,(H,24,26)(H,28,29)/b17-11+ |
| InChIKey | WISQIXWFDRMKEA-GZTJUZNOSA-N |
| XLogP | 2.24 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|