C11H12Cl2N2O3S — CID 61128272
N-(2,6-dichloro-4-sulfamoylphenyl)-3-methylbut-2-enamide (PubChem CID 61128272) has the molecular formula C11H12Cl2N2O3S and a molecular weight of 323.20 g/mol. Its IUPAC name is N-(2,6-dichloro-4-sulfamoylphenyl)-3-methylbut-2-enamide.
| Compound Name | N-(2,6-dichloro-4-sulfamoylphenyl)-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 61128272 |
| Molecular Formula | C11H12Cl2N2O3S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | N-(2,6-dichloro-4-sulfamoylphenyl)-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1c(Cl)cc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O3S/c1-6(2)3-10(16)15-11-8(12)4-7(5-9(11)13)19(14,17)18/h3-5H,1-2H3,(H,15,16)(H2,14,17,18) |
| InChIKey | WWHRRRHCYKQQSJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|