C11H8Cl2N4O3S — CID 102922062
N-(2,6-dichloro-4-sulfamoylphenyl)pyrimidine-5-carboxamide (PubChem CID 102922062) has the molecular formula C11H8Cl2N4O3S and a molecular weight of 347.18 g/mol. Its IUPAC name is N-(2,6-dichloro-4-sulfamoylphenyl)pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dichloro-4-sulfamoylphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 102922062 |
| Molecular Formula | C11H8Cl2N4O3S |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | N-(2,6-dichloro-4-sulfamoylphenyl)pyrimidine-5-carboxamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(NC(=O)c2cncnc2)c(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2N4O3S/c12-8-1-7(21(14,19)20)2-9(13)10(8)17-11(18)6-3-15-5-16-4-6/h1-5H,(H,17,18)(H2,14,19,20) |
| InChIKey | DKLIMURMNYYBBV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |