C13H18Cl2N3O3S+ — CID 9249472
N-(2,6-dichloro-4-sulfamoylphenyl)-2-piperidin-1-ium-1-ylacetamide (PubChem CID 9249472) has the molecular formula C13H18Cl2N3O3S+ and a molecular weight of 367.28 g/mol. Its IUPAC name is N-(2,6-dichloro-4-sulfamoylphenyl)-2-piperidin-1-ium-1-ylacetamide.
| Compound Name | N-(2,6-dichloro-4-sulfamoylphenyl)-2-piperidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 9249472 |
| Molecular Formula | C13H18Cl2N3O3S+ |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | N-(2,6-dichloro-4-sulfamoylphenyl)-2-piperidin-1-ium-1-ylacetamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(NC(=O)C[NH+]2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N3O3S/c14-10-6-9(22(16,20)21)7-11(15)13(10)17-12(19)8-18-4-2-1-3-5-18/h6-7H,1-5,8H2,(H,17,19)(H2,16,20,21)/p+1 |
| InChIKey | RHLIJORMPWALIA-UHFFFAOYSA-O |
| XLogP | 0.65 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |