C12H14Cl3N2O+ — CID 8901846
2-pyrrolidin-1-ium-1-yl-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 8901846) has the molecular formula C12H14Cl3N2O+ and a molecular weight of 308.62 g/mol. Its IUPAC name is 2-pyrrolidin-1-ium-1-yl-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-pyrrolidin-1-ium-1-yl-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 8901846 |
| Molecular Formula | C12H14Cl3N2O+ |
| Molecular Weight | 308.62 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-pyrrolidin-1-ium-1-yl-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CCCC1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl3N2O/c13-8-5-10(15)11(6-9(8)14)16-12(18)7-17-3-1-2-4-17/h5-6H,1-4,7H2,(H,16,18)/p+1 |
| InChIKey | WIROSFUACGFQGL-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.62 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|