C18H18Cl3FN3O+ — CID 2539642
2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 2539642) has the molecular formula C18H18Cl3FN3O+ and a molecular weight of 417.72 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2539642 |
| Molecular Formula | C18H18Cl3FN3O+ |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccccc2F)CC1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl3FN3O/c19-12-9-14(21)16(10-13(12)20)23-18(26)11-24-5-7-25(8-6-24)17-4-2-1-3-15(17)22/h1-4,9-10H,5-8,11H2,(H,23,26)/p+1 |
| InChIKey | HLPGPYSWCKZXNX-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|