C14H17Cl3N2O — CID 64685123
2-(1-aminocyclohexyl)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 64685123) has the molecular formula C14H17Cl3N2O and a molecular weight of 335.66 g/mol. Its IUPAC name is 2-(1-aminocyclohexyl)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(1-aminocyclohexyl)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 64685123 |
| Molecular Formula | C14H17Cl3N2O |
| Molecular Weight | 335.66 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-(1-aminocyclohexyl)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | NC1(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)CCCCC1 |
| InChI | InChI=1S/C14H17Cl3N2O/c15-9-6-11(17)12(7-10(9)16)19-13(20)8-14(18)4-2-1-3-5-14/h6-7H,1-5,8,18H2,(H,19,20) |
| InChIKey | NKOKBCRTCHXFNC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|